On Target ACM4_HUMAN 0.44705883/CHEMBL4082397
For the given ligand test, we have found in our database that, being scored 0.44705883, the most similar ligand is CHEMBL4082397. Check out the elaboration below.
| test (Given Ligand) | CHEMBL4082397 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CC1(C)CCCN(C1)c2ccc(nn2)N3CCN(CC3)S(=O)(=O)c4ccccc4Cl |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 0000c093 01801009 21100020 05b00600 20080000 00002000 00820000 20000000 00000000 10004ac0 00202004 70018800 02000006 00002001 80220000 0014c00c 00042000 00000008 08600000 00226605 80100000 3c040100 20800820 2a50803a 02122000 00080004 20000000 100000cc 08000418 20060000 00000c02 20332260 |