On Target BACE1_HUMAN 0.42081448/CHEMBL1097346
For the given ligand test, we have found in our database that, being scored 0.42081448, the most similar ligand is CHEMBL1097346. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1097346 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CCNc1cc(cc(c1)C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)[C@H]3CN(CCN3)S(=O)(=O)c4cccc(C)c4)N(C)S(=O)(=O)C |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 1000409a 03805c00 41100302 07b10600 00080180 08010010 00020800 22001004 00b00880 004929f0 08302004 f0038000 00008c02 00203001 817814c0 100a8108 10042000 02400400 08e02000 00006605 c0100100 382e8e10 230000e1 bb50003c 020c0081 c0100004 80008400 9000108d 2cf08506 20068017 a0040002 00010670 |