On Target NOS1_HUMAN 0.36138615/CHEMBL491922
For the given ligand test, we have found in our database that, being scored 0.36138615, the most similar ligand is CHEMBL491922. Check out the elaboration below.
| test (Given Ligand) | CHEMBL491922 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CC1=C(CNCC1)C(=O)N(CC2=CC(=O)Nc3c(F)c(F)ccc23)c4cccc(Cl)c4 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 0000c212 08808c00 00104100 07010600 20040000 00000070 08180100 22001400 07000000 403009e0 04280004 7000d808 8a008906 00711001 00120440 00040204 20041008 02002140 08210012 00184201 e0100000 18008788 2081a000 c0500018 01007000 c0000000 00480220 90000893 00008100 04078411 24048800 00022220 |