On Target NK1R_HUMAN 0.479798/CHEMBL321098
For the given ligand test, we have found in our database that, being scored 0.479798, the most similar ligand is CHEMBL321098. Check out the elaboration below.
| test (Given Ligand) | CHEMBL321098 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | COc1ccc(OC)c(c1)S(=O)(=O)N2CCC3(CC2)C4C(CN3C(=O)c5cc(cc(c5)C(F)(F)F)C(F)(F)F)C(=O)N(C4=O)c6ccccc6 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00034012 018a1c08 21100108 01b10600 20081401 00042010 12000400 22041000 00200000 004009f0 00282004 70039002 0c00881b 11100001 81e20641 08000008 010c2201 02000001 08402010 00027703 e0121000 180e8630 20002000 1850001c 02009000 c008000c 08080000 9100008c 00008702 20060013 a0140000 02813278 |