On Target OPRK_HUMAN 0.46853146/CHEMBL1710945
For the given ligand test, we have found in our database that, being scored 0.46853146, the most similar ligand is CHEMBL1710945. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1710945 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CC(C)N(CCNC(=O)c1ccc(CNS(=O)(=O)c2cccc(C)c2)cc1)Cc3ccc(C)cc3 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00000010 00802800 01080100 45b10600 00080100 00010000 04000001 02001008 00000100 00011840 00302000 60008000 80008802 00002001 80200480 00000100 00002000 02100000 00400000 00006000 80000000 28028600 00000000 0a40001c 02000000 c0000004 40000000 8000100c 08000500 20060001 80040000 00010360 |