On Target ALDR_HUMAN 0.42424244/CHEMBL240719
For the given ligand test, we have found in our database that, being scored 0.42424244, the most similar ligand is CHEMBL240719. Check out the elaboration below.
| test (Given Ligand) | CHEMBL240719 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | Cc1ccccc1CC(=O)Nc2cc(C)c(c(C)c2)S(=O)(=O)NCC(=O)O |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00004012 00802000 41100100 01b10600 24088031 00000008 00000000 00000008 00040000 00080850 08282004 6000b000 01008000 00300001 c0320040 00080008 00042280 02000000 08400000 00006400 c0140000 18200e01 22106000 c9400059 02042000 80000104 00000000 000000cc 04408400 20060003 00002000 00010660 |