On Target AA1R_HUMAN 0.39130434/CHEMBL1760893
For the given ligand test, we have found in our database that, being scored 0.39130434, the most similar ligand is CHEMBL1760893. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1760893 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CCN(C(=O)C)c1ccc(OC)c2nc(NC(=O)C3CCN(CC3)S(=O)(=O)c4cccc(c4)C(F)(F)F)sc12 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00034092 13880008 61180108 01b10600 000c1108 00818404 83008500 30328118 04600000 214098d2 00382a04 f0079400 0c008032 0b500003 816020cb 0014050c 00042000 02004080 08600012 00a26601 c0100000 5c040680 60806800 1a610018 02000000 8c200404 40040080 90001c8c 00008618 280e2a01 00101000 04c14770 |