On Target PGH1_SHEEP 0.39130434/CHEMBL8916
For the given ligand test, we have found in our database that, being scored 0.39130434, the most similar ligand is CHEMBL8916. Check out the elaboration below.
| test (Given Ligand) | CHEMBL8916 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | Cc1cccc(C)c1N2C(=O)c3ccccc3C2=O |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00004002 00800800 00000100 10010600 00000001 00008040 00000080 02001000 00000000 00000840 00280004 4000c000 00008802 00300000 00020440 00000008 00042000 02000000 08100000 00000000 c0120000 08028680 20012000 0044000c 00000000 c0200000 00000010 80001080 00008100 00060001 80040020 00000200 |