On Target NMDE2_HUMAN 0.30864197/CHEMBL444384
For the given ligand test, we have found in our database that, being scored 0.30864197, the most similar ligand is CHEMBL444384. Check out the elaboration below.
| test (Given Ligand) | CHEMBL444384 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | O=C(CN1CCC(Cc2ccccc2)CC1)c3c[nH]c4ccccc34 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00000002 01801800 00100102 41010610 00041000 00000000 00002000 20000004 00500880 000908c0 08300004 5001a000 12008802 00600000 80000040 00040004 00000000 02000000 00200400 00000201 c0000100 18228208 20800000 9150001c 00042000 80000000 08000000 10000000 04000000 00060002 80044200 00002620 |