On Target AGTR2_HUMAN 0.37656903/CHEMBL74144
For the given ligand test, we have found in our database that, being scored 0.37656903, the most similar ligand is CHEMBL74144. Check out the elaboration below.
| test (Given Ligand) | CHEMBL74144 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CCC1=Nc2ccc(NC(=O)c3ccccn3)cc2C(=O)N1Cc4ccc(cc4F)c5ccccc5S(=O)(=O)NC(=O)OCCC(C)C |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 0000601a 00e00a01 01104100 16b10f00 000e0020 00104030 00001800 82801001 86100108 500028e0 0129a00d 7081c000 800b9808 00f11101 883200c0 021c010c 02062280 0200c008 0c680000 10016005 c0100000 18028e38 31a1a041 8978041c 0010a004 c0000083 a0080040 800400cf 0400c704 2046804b c02c5000 600142e0 |