On Target OPRM_MOUSE 0.37583894/CHEMBL283552
For the given ligand test, we have found in our database that, being scored 0.37583894, the most similar ligand is CHEMBL283552. Check out the elaboration below.
| test (Given Ligand) | CHEMBL283552 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | Oc1c(Br)cc(Br)cc1C(=O)Nc2cccc(c2)C(F)(F)F |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00004002 20008808 60100100 00010600 04000000 00020000 02000400 0a001400 40000000 00000850 10280004 c000c004 00008812 01100001 00000140 00002008 00040000 02000000 08000000 00020010 40100000 08028600 20012000 00400004 00040000 80000000 00420000 90000080 00408100 00062001 84140008 08000200 |