On Target AA2AR_HUMAN 0.41919193/CHEMBL486282
For the given ligand test, we have found in our database that, being scored 0.41919193, the most similar ligand is CHEMBL486282. Check out the elaboration below.
| test (Given Ligand) | CHEMBL486282 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CCCN1C(=O)Nc2nc([nH]c2C1=O)c3ccc(cc3)S(=O)(=O)NC4CCN(Cc5ccccc5)CC4 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 0000803a 01801c00 01180100 13b10600 00080068 0000c000 00009000 22081408 16400100 904019e0 0c20a00c 70018800 02009802 00d01001 80aa0480 080c000c 00002000 0200a000 00400000 00407603 80000100 38008050 21802041 1870001c 02040000 c020000c 60000000 9004002c 00004504 20460c10 e00c0800 400102e0 |