On Target DRD4_HUMAN 0.49704143/CHEMBL106917
For the given ligand test, we have found in our database that, being scored 0.49704143, the most similar ligand is CHEMBL106917. Check out the elaboration below.
| test (Given Ligand) | CHEMBL106917 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CN(C)S(=O)(=O)c1ccc2N(CCc2c1)C(=O)CN3CCN(Cc4ccc(Cl)cc4)CC3 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 0000c012 00803000 01102120 04b10600 20000110 00010040 00000000 0200100c 00800080 00090a40 08282024 6000e800 02008846 00102001 802205c0 00000100 0024a000 02000000 08400000 00006200 c0100000 38208700 20002023 8b40001b 00002000 c0000000 00040010 800010cc 0c088500 20060003 00044000 20030661 |