On Target OPRD_HUMAN 0.44285715/CHEMBL571324
For the given ligand test, we have found in our database that, being scored 0.44285715, the most similar ligand is CHEMBL571324. Check out the elaboration below.
| test (Given Ligand) | CHEMBL571324 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CCN(CC)C(=O)c1ccc(cc1)N(C2CCN(C)CC2)c3cccc(O)c3 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00004002 81000c08 20100100 80810600 20000000 00000000 02000010 02001000 00002000 000009e0 00200004 50018000 00008802 00008000 00020440 00000008 00040080 02000000 08000002 00022601 60100000 18028600 20000000 0050001c 00000000 c0000000 02000000 90000080 00008100 00060011 80040000 00000200 |