On Target OPRX_HUMAN 0.5106383/CHEMBL3942616
For the given ligand test, we have found in our database that, being scored 0.5106383, the most similar ligand is CHEMBL3942616. Check out the elaboration below.
| test (Given Ligand) | CHEMBL3942616 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CN(C)C1(CCC(C)(CNS(=O)(=O)c2ccc(Cl)cc2)CC1)c3ccccc3 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00008010 01800200 01100102 01b10600 00080000 10000000 00000000 02001000 00000800 004808c0 08302000 60018800 02000804 00200001 80600000 00000000 00002000 02000000 02402000 00006401 80000100 18008130 00000000 18500018 02002000 80000004 10000000 9000000c 00000502 20060002 00060000 00030670 |