On Target CDK5_HUMAN 0.4275862/CHEMBL1967612
For the given ligand test, we have found in our database that, being scored 0.4275862, the most similar ligand is CHEMBL1967612. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1967612 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | Clc1ccc2c(c1)C(=O)NS2(=O)=O |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00008010 08800a00 01080100 01b10600 00080400 10000000 04000001 00001002 00000200 00003840 00102000 60108800 12008804 00000001 a0300000 00000000 02002080 02100000 00400000 00006000 80000000 08028700 00000000 0840000c 02002000 80000004 50000000 0000000c 00000400 20060800 80040000 00030360 |