On Target HRH1_HUMAN 0.479798/CHEMBL2207654
For the given ligand test, we have found in our database that, being scored 0.479798, the most similar ligand is CHEMBL2207654. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2207654 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | O[C@H](CNC(=O)C1=CNC(=O)c2cc(ccc12)S(=O)(=O)N3CCC3)CN4CCC(CC4)Oc5ccc(Cl)c(Cl)c5 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 1400801a 0180dc08 21106108 01b10610 000c1080 02000060 92004000 22001000 06000000 404009e0 05202004 70018800 02808806 00600003 817804c3 000c200c 10222000 02000404 00e00000 00026e01 c0000000 180e8f08 23804080 9850041c 020c2001 c0100106 08100000 9000000c 00400700 20060011 a0040000 a0032260 |