On Target NMDE1_HUMAN 0.39375/CHEMBL2333945
For the given ligand test, we have found in our database that, being scored 0.39375, the most similar ligand is CHEMBL2333945. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2333945 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | Fc1ccc(cc1Cl)S(=O)(=O)NCc2ccc(cc2)C(=O)NNC(=O)c3ccccc3 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00008014 08808800 01180100 43b10600 00080000 00000010 04000801 00001000 00000100 40001848 40102000 60008800 82008804 00201201 a0200000 00000004 00002000 02100000 04400000 00006000 80000000 08028702 40000000 0840000c 02002000 80101004 40000000 0000000d 00000400 204e8002 80040000 001703e0 |