On Target MK03_HUMAN 0.3519553/CHEMBL1336
For the given ligand test, we have found in our database that, being scored 0.3519553, the most similar ligand is CHEMBL1336. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1336 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)ccc1O)c3cccc(S(=O)(=O)N2CCCCC2)c3 | CNC(=O)c1cc(Oc2ccc(NC(=O)Nc3ccc(Cl)c(c3)C(F)(F)F)cc2)ccn1 |
|
|
|
|
|
|
| 0000c012 01800809 21104100 01b10600 00080120 00010000 0a000000 02001000 01000000 004008c0 00282004 7001c800 02008806 00100001 806000c0 00004108 00042000 06000000 08410000 00026601 c0100000 18028700 20012000 1840801c 02002000 80000004 20100040 9000108c 00008500 20060001 80040000 40030270 | 00008006 44000808 20104108 10010e40 04041020 00100000 02000400 02003009 00000000 00000850 00290004 40008804 02008826 09100000 01024041 2204010c 00040000 02000004 08282000 00060010 40402100 08028700 20822000 00448004 00142000 80000200 000c0040 90200080 00408384 00060001 80140400 02264200 |