On Target NMDE1_HUMAN 0.28440368/CHEMBL284237
For the given ligand fentanyl, we have found in our database that, being scored 0.28440368, the most similar ligand is CHEMBL284237. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL284237 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | C[C@]12N[C@H](Cc3ccccc13)c4ccccc24 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00000008 00000000 00100100 10010600 00000020 00000002 00000400 03001001 04000880 00080840 08300000 40808000 00000802 00200000 00000400 00000080 00002000 02000020 00100000 00000201 00020100 18308000 00404000 81400810 00000000 e0200001 00004000 c0000000 06000180 00860002 20040000 00000700 |