On Target ACES_HUMAN 0.5/CHEMBL3818616
For the given ligand CBDCOOH, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL3818616. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL3818616 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | Oc1cccc2C\C(=C/C3CCN(Cc4ccccc4)CC3)\C(=O)c12 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 43000c08 20100102 00010602 00000000 40828000 02000081 22001602 91040800 009808c0 08300000 50019040 04028802 00201000 00000400 00022008 00004004 02100000 00210008 00020a01 00000100 180282c0 0000c000 00500014 00200800 c0000000 00400000 90000000 04000100 00064002 a4040000 00000600 |