On Target TRPV1_RAT 0.4064516/CHEMBL98634
For the given ligand CBDCOOH, we have found in our database that, being scored 0.4064516, the most similar ligand is CHEMBL98634. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL98634 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1cc(CC(=O)OCC2=C[C@H]3[C@@H]4C(C)(C)[C@@]4(C[C@@H](C)C3(O)[C@@H]5C=C(C)C(=O)[C@]5(C2)OC)OC(=O)Cc6ccccc6)ccc1O |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00050040 c3000008 20000908 80010300 00381041 00000800 02000280 28000442 01000000 01180848 48000200 4000d000 0502c02a 23800000 41040405 00089008 08820000 82000000 37492010 0202a201 00010020 08000a80 0100a000 00400010 00201480 80200400 00524200 80011000 00000200 80020002 24022000 00800410 |