On Target FABP5_HUMAN 0.33333334/CHEMBL8659
For the given ligand CBDCOOH, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL8659. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL8659 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CCCCCCCC\C=C/CCCCCCCC(=O)O |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00010000 01000000 00000000 00000000 00080000 00000000 00000000 00000402 00000000 00100000 00000000 40001000 04028008 00800000 00000400 00080008 00000000 00000000 00402000 00000001 00000000 00000a00 01008000 00000010 00200000 00000000 00404000 80000000 00000000 00000000 24020000 00000000 |