On Target PAR1_HUMAN 0.3529412/CHEMBL231695
For the given ligand CBDCOOH, we have found in our database that, being scored 0.3529412, the most similar ligand is CHEMBL231695. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL231695 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1ccc2nc(\C=C\[C@H]3[C@@H]4[C@@H](C)OC(=O)[C@@H]4Cc5ccccc35)ccc2c1 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00050142 81000008 2000430a 90010700 000c1020 00800002 83081081 08000409 80000800 00b88848 08100004 40009000 04028806 00600000 010a0463 020c100c 00820600 0a100000 00602008 00032801 40000120 08008a08 2180c060 80410010 01002c00 82000001 00406040 c0008200 00400206 00060002 24040000 00400400 |