On Target SC6A4_HUMAN 0.44285715/CHEMBL185169
For the given ligand CBDCOOH, we have found in our database that, being scored 0.44285715, the most similar ligand is CHEMBL185169. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL185169 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COC(=O)C1=C(CC2CCC1O2)c3ccc4ccccc4c3 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00050040 01000008 00000b02 00010300 000c0040 00200800 82000280 28000402 01800800 01180848 48100200 40009000 14028008 00a00000 00080406 00081008 00820400 02000000 2141a018 00008001 20000120 18001a88 0100a060 00400010 01201480 80000400 00406000 c0000400 00400202 00020002 24020000 00000410 |