On Target MK01_HUMAN 0.47297296/CHEMBL2012519
For the given ligand CBDCOOH, we have found in our database that, being scored 0.47297296, the most similar ligand is CHEMBL2012519. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL2012519 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1cc(O)c2C(=O)O[C@@H](C)C\C=C/C(=O)[C@@H](O)[C@@H](O)CCCc2c1 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00010001 c3000808 2000090b 00010200 00081010 4002c400 42140280 00000c02 01000900 00180840 08100200 4000d800 1402800a 20a10000 01000425 02082008 00020800 02000000 00492000 0002aa01 00400520 28021ae0 0500e000 00400014 00200400 80002201 004a6000 80000000 00000203 00020002 e4020000 02000400 |