On Target HYES_HUMAN 0.36923078/CHEMBL1358
For the given ligand CBDCOOH, we have found in our database that, being scored 0.36923078, the most similar ligand is CHEMBL1358. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL1358 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | C[C@]12CC[C@H]3[C@@H]([C@H](CCCCCCCCC[S+]([O-])CCCC(F)(F)C(F)(F)F)Cc4cc(O)ccc34)[C@@H]1CC[C@@H]2O |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 43000008 20100102 00510200 00080000 40000002 0a000000 00000201 05200800 00084840 08100000 40128040 00010002 00a40000 00000020 00080008 04000200 02000000 02402000 00020201 40000100 08000000 01004300 00f00010 00000000 80000009 00120020 90000000 0000002a 03024022 00020000 01010600 |