On Target TRPV3_HUMAN 0.33734939/CHEMBL3664218
For the given ligand CBDCOOH, we have found in our database that, being scored 0.33734939, the most similar ligand is CHEMBL3664218. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL3664218 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1cccc(CNC(=O)CC2CC3(CCC3)Oc4ccc(Cl)cc24)c1OC5CCCC5 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 04018000 45800218 2010010a 00210700 00081000 82000100 06000000 22001600 00000800 001808c0 08300000 40019840 0680c82e 01200010 91000601 020ca008 00800000 22008400 00482008 00020201 80000140 18008710 01000040 00548418 00002800 c0000000 00100000 90000000 00000302 0106c00b 24060000 00020640 |