On Target TNFA_HUMAN 0.38265306/CHEMBL2337619
For the given ligand CBDCOOH, we have found in our database that, being scored 0.38265306, the most similar ligand is CHEMBL2337619. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL2337619 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CCCCCCOC(=O)\C=C\c1cc(OC)c(O)c2c1C[C@@H]3[C@@H]4C=C(OC)C(=O)C[C@]24CCN3C |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 100d0000 4b000208 2010010a 00110700 20081021 c0002002 870c0180 2000060b 01800880 001888ca 48300000 5191d040 8402c01a 20a00000 03000423 020cb00a 20820600 82000060 2049a018 00020201 00100120 18200a90 0100c001 81540010 00201c00 80002001 04526008 d0000580 04404202 0026c50a 2c020000 00012710 |