On Target DRD2_HUMAN 0.37301588/CHEMBL292186
For the given ligand CBDCOOH, we have found in our database that, being scored 0.37301588, the most similar ligand is CHEMBL292186. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL292186 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1cc2ccccc2cc1C(=O)CCC3CCN(Cc4ccccc4)CC3 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00010000 01000808 2010010a 00010600 00001000 00020000 02000000 22001200 00000800 000808c0 08300000 50019040 0400880a 00200000 01000401 00002008 00000000 02000000 00002000 00020201 00000100 18028218 00000000 00500414 00000000 c0000000 00000800 90000000 00000302 00064002 a0060000 00000600 |