On Target NEP_HUMAN 0.37719297/CHEMBL4070297
For the given ligand CBDCOOH, we have found in our database that, being scored 0.37719297, the most similar ligand is CHEMBL4070297. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL4070297 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | OC(=O)[C@@H](CC(=O)C1(S)CCCCC1)Cc2ccc(cc2)c3ccccc3 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00052000 01000000 00000102 00110200 00080008 00000000 00000000 00000000 00a00900 00080840 08100000 40029800 04008008 00a40000 00000000 00080008 00020000 02000000 06402008 10000001 00000100 08000a00 11000140 00400010 00000800 80000000 00000000 00000040 00004002 00020002 00020000 01410400 |