On Target HPGDS_HUMAN 0.28688523/CHEMBL1743209
For the given ligand CBDCOOH, we have found in our database that, being scored 0.28688523, the most similar ligand is CHEMBL1743209. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL1743209 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CCCCC[C@H](O)\C=C\[C@@H]1[C@@H](C\C=C/CCCC(=O)O)C2CC1OO2 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00010000 81040000 00000800 00000000 00280000 00080001 00000000 28000402 00000000 00108008 00000200 40001000 04128000 00800080 00000404 00080028 00100800 00000010 21402010 00002001 01004000 20020a00 01008000 00000010 00201000 00000400 00424204 80001000 00000000 01000000 24020001 00000000 |