On Target NOS1_HUMAN 0.2578125/CHEMBL298404
For the given ligand CBDCOOH, we have found in our database that, being scored 0.2578125, the most similar ligand is CHEMBL298404. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL298404 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | NC(Cc1ccccc1N=C(N)N)C(=O)O |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00000002 00000000 00000100 00010e00 00000000 00000000 02002000 00000000 00000800 00080842 08100004 4000b000 04009000 40000008 000200c0 00080008 00000800 02000000 01400018 00000001 40000100 18010a00 23000040 81400010 00080800 88000000 40800000 00000800 04000000 00860002 00080000 20000500 |