On Target NK1R_HUMAN 0.35/CHEMBL1817891
For the given ligand CBDCOOH, we have found in our database that, being scored 0.35, the most similar ligand is CHEMBL1817891. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL1817891 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | Cl.COc1ccc(OC(F)(F)F)cc1CN2CCC(=O)C(C2)C(c3ccccc3)c4ccccc4 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 45000208 2010010a 00010600 00011010 00000100 02000000 23001400 00000800 001808c0 08300000 50419000 0c008802 00200000 01000401 00042008 00000000 02000000 00082018 00020201 00000100 18008210 00000008 00548010 00001800 e0000000 00080000 d0000000 02000382 0006000a 24040000 02022600 |