On Target OPRK_HUMAN 0.5241379/CHEMBL4114012
For the given ligand CBDCOOH, we have found in our database that, being scored 0.5241379, the most similar ligand is CHEMBL4114012. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL4114012 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | OC(=O)CCC[C@]12CCN(CC3CC3)[C@H](Cc4ccc(O)cc14)/C/2=C\C(=O)O |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00010000 43008608 20100102 00110600 00080020 40800002 02100081 28000401 91000880 009808c2 08300000 50819000 0402800a 01a10000 00000420 020c0008 20004200 02100100 00412010 00030a01 00000100 18200b90 0100c000 81540010 00001000 8c00cc01 005a4000 90000000 04000002 0006000a 24020000 02012600 |