On Target PGH1_SHEEP 0.3557047/CHEMBL3400659
For the given ligand CBDCOOH, we have found in our database that, being scored 0.3557047, the most similar ligand is CHEMBL3400659. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL3400659 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CCC(C)C(=O)O[C@@]12[C@H](OC(=O)c3ccccc3)[C@@H](C)[C@@]4(O)[C@@H](C=C(CO)C[C@@]5(O)[C@H]4C=C(C)C5=O)[C@@H]1C2(C)C |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00050040 81000800 80000d08 80010300 00280050 00004000 00000280 28000442 01002100 01100848 00000200 4000d000 04028028 03810000 00000404 02089008 00820000 02000000 13412010 02002001 00000020 08020aa0 05008000 08400014 00201480 80202400 00484200 80001020 00000200 8002000a e4020000 02000000 |