On Target NMDE2_HUMAN 0.34351146/CHEMBL3357783
For the given ligand CBDCOOH, we have found in our database that, being scored 0.34351146, the most similar ligand is CHEMBL3357783. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL3357783 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1ccc2C(O)CC(CCc2c1)NCCCc3ccccc3 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 43000208 2010010a 00010600 00081000 40004002 02040000 20000001 00000900 000808c0 08300000 40008800 00000002 20a00000 01000021 020c0008 01000000 02000000 00c82000 00020201 00000500 18000020 01004080 00400010 00000001 80000201 00520000 10000000 00000202 0006000a 40020000 00002600 |