On Target P2RX3_HUMAN 0.3315508/CHEMBL3679817
For the given ligand CBDCOOH, we have found in our database that, being scored 0.3315508, the most similar ligand is CHEMBL3679817. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL3679817 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1ccccc1C2C(C(=O)CC(C)(C)C(=O)O)C(=O)C(=O)N2c3ccc(cc3)c4ccsc4 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 0007e002 01801808 2010090a 00010600 20181000 00002110 46000000 22001680 04100900 001808c0 08380204 5001f0c0 0e00880a 00b08001 81021641 00082008 00060000 02000001 0c402018 00020201 c0100100 58068e90 31012000 00500418 00801800 c4100080 00000000 900000c4 0000c302 00064003 24065000 00c10600 |