On Target DRD3_HUMAN 0.62184876/CHEMBL4100634
For the given ligand CBDCOOH, we have found in our database that, being scored 0.62184876, the most similar ligand is CHEMBL4100634. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL4100634 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CCCCCCC(C)(C)c1ccc2[C@@H]3C=C(CO)CC[C@H]3C(C)(C)Oc2c1 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 04000000 c3000018 2000010a 80010302 00081000 c2800000 02000001 08000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682010 00022a01 00000100 08000000 01008040 00400410 00201000 c0004400 00404000 80000000 00000302 00024002 24020000 00000400 |