On Target AGTR2_HUMAN 0.29473683/CHEMBL154057
For the given ligand CBDCOOH, we have found in our database that, being scored 0.29473683, the most similar ligand is CHEMBL154057. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL154057 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1ccc2CN(C(Cc2c1OCc3ccccc3)C(=O)O)C(=O)C(C4CCCC4)c5ccccc5 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 04018008 47805008 2010010a 10210600 000010a0 c0004000 07041000 22001204 00000980 000808c0 08300000 4001b0c0 0780c88a 20210080 c1080481 0208a008 90000200 02008020 00482008 00020201 80020100 18208e30 03004040 81d49418 00004800 c0002001 00224000 90000000 04000302 0187000b 60066000 00002600 |