On Target OPRM_MOUSE 0.42/CHEMBL2017152
For the given ligand CBDCOOH, we have found in our database that, being scored 0.42, the most similar ligand is CHEMBL2017152. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL2017152 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | Oc1ccc2CC34CN(CC5CC5)CCC3(CC=C(C4)C(=O)NCc6ccccc6)c2c1 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00010010 43808208 20100102 00110600 00000000 40000002 02100080 22001403 11000800 001808c2 08300000 50019000 0402891a 01211000 00000420 02060108 20004000 02000120 00012000 00020201 80000100 180086b0 0000c000 00540018 00200000 c0002001 005a4200 90000000 04000102 0006000b 24060000 00012600 |