On Target P2Y12_HUMAN 0.2937063/CHEMBL420980
For the given ligand CBDCOOH, we have found in our database that, being scored 0.2937063, the most similar ligand is CHEMBL420980. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL420980 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COC(=O)CCCCc1ccc2[nH]c3nc(O)nc3cc2c1 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00014002 03004810 00084102 00010300 000c0040 0000c000 00008000 00000000 00400900 00080840 08108004 40009000 04008808 00e00000 60040140 000c000c 08820000 02000004 00602000 00000001 40020100 08008a28 21800000 80400014 00000000 80000000 00028040 00000000 00400202 00420002 c0040000 0c000480 |