On Target NOS2_HUMAN 0.36633664/CHEMBL1765578
For the given ligand CBDCOOH, we have found in our database that, being scored 0.36633664, the most similar ligand is CHEMBL1765578. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL1765578 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC1(C)CC[C@@]2(CC[C@]3(C)[C@@H]([C@@H]2C1)C(=O)C=C4[C@@]5(C)C=CC(=O)C(C)(C)[C@@H]5CC[C@@]34C)C(=O)O |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00010002 01000000 00000000 00080000 00080000 00000000 00000080 00000402 01000000 00128000 00000000 40001000 04028028 00800000 00000400 00080008 00000000 00000020 02412000 00020001 00000001 00000a80 01008000 00000810 00200000 00000000 00404000 80000000 00000000 00000000 24020000 00000000 |