On Target SCN9A_HUMAN 0.39849624/CHEMBL203440
For the given ligand CBDCOOH, we have found in our database that, being scored 0.39849624, the most similar ligand is CHEMBL203440. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL203440 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | OC(CCc1cccc(OC(F)(F)F)c1)[C@@H]2CCC[C@H]2C(=O)NCc3ccccc3 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00050000 43800008 2010010a 00010600 00191010 40000000 02000000 22001000 00000800 000808c0 08300000 40419000 0400880a 20a00000 01000401 00080008 00000000 02000000 00482000 00020201 80000100 18008610 01000048 00500018 00000000 c0000000 00000000 d0000000 02000302 01060003 20060000 00000e00 |