On Target AA2AR_HUMAN 0.2846154/CHEMBL2042091
For the given ligand CBDCOOH, we have found in our database that, being scored 0.2846154, the most similar ligand is CHEMBL2042091. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL2042091 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COC(=O)\C(=C\c1cccc(OC)c1O)\C#N |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 40000008 20000108 00010220 00201000 00080000 82000080 00000400 01808000 00000840 40000000 40129000 0c00c002 00000000 01000003 0008a008 00420400 02000000 10098018 00020200 00000000 08000a00 01000400 00400010 00001000 80000000 00402100 40000400 00480200 00020100 04000000 00000192 |