On Target CXCR1_HUMAN 0.2920792/CHEMBL556862
For the given ligand CBDCOOH, we have found in our database that, being scored 0.2920792, the most similar ligand is CHEMBL556862. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL556862 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC[C@@H](NC1=C(Nc2cccc(C(=O)N3CCCC3C(=O)O)c2O)C(=O)C1=O)c4ccccc4 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 1041c00a 01005808 60100102 00012600 20090081 68022010 020000a0 22401500 05a00c40 001808d0 08380004 5043b000 0e008812 01200000 800a0440 10086048 10050001 22008000 08630210 20020201 48100980 18168e00 23000000 0050801c 04041000 c0000080 20400010 900c0580 20508102 20060003 a4045420 40002600 |