On Target 5HT1B_HUMAN 0.3904762/CHEMBL146942
For the given ligand CBDCOOH, we have found in our database that, being scored 0.3904762, the most similar ligand is CHEMBL146942. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL146942 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | NCCCC1(CCCN)CCc2cccc(O)c2C1 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00000000 43000008 20000102 00010600 00000000 40000002 02000000 00000201 00000800 000808c0 08100000 40018040 00000002 00200000 00000020 00002008 00000200 02000000 00002000 00020201 00000100 18000010 00004000 00400010 00000000 80000001 00000000 00000000 00000002 00064002 00020000 00000400 |