On Target TLR4_HUMAN 0.35099337/CHEMBL4071705
For the given ligand CBDCOOH, we have found in our database that, being scored 0.35099337, the most similar ligand is CHEMBL4071705. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL4071705 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | C[C@@H](OC(=O)c1ccccc1O)[C@]2(O)CC[C@]3(O)[C@]4(O)CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4C[C@@H](OC(=O)\C=C\c6ccccc6)[C@]23C |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 00040000 81000808 a0000d00 00010300 00280050 00024000 82000080 00000c02 01800100 01100848 40000200 40008000 04028002 02810000 00000406 02083008 00820c00 02000020 3341a018 00022001 00000020 28020a20 05008000 08400014 00201400 80002000 00486000 c0000420 00400200 0102000a e4020000 02000010 |