On Target OPRD_HUMAN 0.45394737/CHEMBL3426789
For the given ligand CBDCOOH, we have found in our database that, being scored 0.45394737, the most similar ligand is CHEMBL3426789. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL3426789 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | Cc1ccccc1COc2ccc(cc2)C3C4=C(CC(C)(C)CC4=O)OC5=C3C(=O)CC(C)(C)C5 |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 04010042 01000008 2000010a 02010301 00081001 00804000 02040081 00020402 01000900 009a8840 08100000 40009800 8482802a 00a10000 03000401 07081408 00800404 02100020 00656008 0a020801 00000121 180002a0 01008000 05c01810 00a00c00 80002000 00525060 80000000 00004243 80020002 66020000 00000400 |