On Target OPRX_HUMAN 0.33497536/CHEMBL3262362
For the given ligand CBDCOOH, we have found in our database that, being scored 0.33497536, the most similar ligand is CHEMBL3262362. Check out the elaboration below.
| CBDCOOH (Given Ligand) | CHEMBL3262362 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C(=O)O)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | CC[C@](O)([C@H]1C[C@]23C=C[C@]1(OC)[C@@H]4Oc5c(O)ccc6C[C@H]2N(CC7CC7)CC[C@@]34c56)C(C)(C)C |
|
|
|
|
|
|
| 00010001 43000008 20000102 00010202 00090000 40800000 02000081 08000602 01040900 00980842 08100000 40409840 0402800a 00a00000 00000400 00082008 00000000 02100020 00612010 00020a01 00000100 08000a80 01008000 00400010 00201000 84004400 04404200 80000000 00000002 00024002 24020000 00010400 | 04001000 cb000208 20100d0a 80310700 00381061 c2000802 02081000 38000643 00002890 011818ca 48300300 51818040 00824002 21a00080 11240425 020ca018 08800200 22008060 17492012 0002a201 00000100 18200010 0500e040 89540410 00201000 c0002401 04524200 90800000 04000302 0007cc0a 24020000 00012f50 |